C28H44N2O2 — CID 142139800
ethane;methyl 2-[4-[4-[[2-(dibutylamino)ethylamino]methyl]phenyl]phenyl]acetate (PubChem CID 142139800) has the molecular formula C28H44N2O2 and a molecular weight of 440.67 g/mol. Its IUPAC name is ethane;methyl 2-[4-[4-[[2-(dibutylamino)ethylamino]methyl]phenyl]phenyl]acetate.
| Compound Name | ethane;methyl 2-[4-[4-[[2-(dibutylamino)ethylamino]methyl]phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 142139800 |
| Molecular Formula | C28H44N2O2 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.34 |
| IUPAC Name | ethane;methyl 2-[4-[4-[[2-(dibutylamino)ethylamino]methyl]phenyl]phenyl]acetate |
| SMILES | CC.CCCCN(CCCC)CCNCc1ccc(-c2ccc(CC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C26H38N2O2.C2H6/c1-4-6-17-28(18-7-5-2)19-16-27-21-23-10-14-25(15-11-23)24-12-8-22(9-13-24)20-26(29)30-3;1-2/h8-15,27H,4-7,16-21H2,1-3H3;1-2H3 |
| InChIKey | WZBBLSMKRCVKCS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|