C22H19N7O — CID 158924015
3-[[4-(7-oxo-8-propyl-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-4-yl)pyrazol-1-yl]methyl]benzonitrile (PubChem CID 158924015) has the molecular formula C22H19N7O and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-[[4-(7-oxo-8-propyl-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-4-yl)pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-(7-oxo-8-propyl-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-4-yl)pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 158924015 |
| Molecular Formula | C22H19N7O |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3-[[4-(7-oxo-8-propyl-1,3,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-4-yl)pyrazol-1-yl]methyl]benzonitrile |
| SMILES | CCCn1c(=O)c2c(n3ccnc13)N=C(c1cnn(Cc3cccc(C#N)c3)c1)C2 |
| InChI | InChI=1S/C22H19N7O/c1-2-7-29-21(30)18-10-19(26-20(18)28-8-6-24-22(28)29)17-12-25-27(14-17)13-16-5-3-4-15(9-16)11-23/h3-6,8-9,12,14H,2,7,10,13H2,1H3 |
| InChIKey | RCCOUGIYBYAWNZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |