C25H27ClN6O2 — CID 58478196
3-[[4-[3-(6-chloro-2,4-dioxo-1-pentyl-5H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]pyrazol-1-yl]methyl]benzonitrile (PubChem CID 58478196) has the molecular formula C25H27ClN6O2 and a molecular weight of 478.98 g/mol. Its IUPAC name is 3-[[4-[3-(6-chloro-2,4-dioxo-1-pentyl-5H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[3-(6-chloro-2,4-dioxo-1-pentyl-5H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 58478196 |
| Molecular Formula | C25H27ClN6O2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-[[4-[3-(6-chloro-2,4-dioxo-1-pentyl-5H-pyrrolo[2,3-d]pyrimidin-3-yl)propyl]pyrazol-1-yl]methyl]benzonitrile |
| SMILES | CCCCCn1c2c(c(=O)n(CCCc3cnn(Cc4cccc(C#N)c4)c3)c1=O)CC(Cl)=N2 |
| InChI | InChI=1S/C25H27ClN6O2/c1-2-3-4-10-31-23-21(13-22(26)29-23)24(33)32(25(31)34)11-6-9-20-15-28-30(17-20)16-19-8-5-7-18(12-19)14-27/h5,7-8,12,15,17H,2-4,6,9-11,13,16H2,1H3 |
| InChIKey | HPYBBNMPLJTHTI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 97.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|