C24H27Cl2N5O2 — CID 58478057
6-chloro-3-[3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]propyl]-1-pentyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 58478057) has the molecular formula C24H27Cl2N5O2 and a molecular weight of 488.42 g/mol. Its IUPAC name is 6-chloro-3-[3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]propyl]-1-pentyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-chloro-3-[3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]propyl]-1-pentyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58478057 |
| Molecular Formula | C24H27Cl2N5O2 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 6-chloro-3-[3-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]propyl]-1-pentyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCCCCn1c2c(c(=O)n(CCCc3cnn(Cc4cccc(Cl)c4)c3)c1=O)CC(Cl)=N2 |
| InChI | InChI=1S/C24H27Cl2N5O2/c1-2-3-4-10-30-22-20(13-21(26)28-22)23(32)31(24(30)33)11-6-8-18-14-27-29(16-18)15-17-7-5-9-19(25)12-17/h5,7,9,12,14,16H,2-4,6,8,10-11,13,15H2,1H3 |
| InChIKey | VWQCUDUPKLLKED-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|