C19H24F2N2O2 — CID 158927185
N-(cyclohexylmethyl)-5-(difluoromethoxy)-N-ethyl-1H-indole-2-carboxamide (PubChem CID 158927185) has the molecular formula C19H24F2N2O2 and a molecular weight of 350.41 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-5-(difluoromethoxy)-N-ethyl-1H-indole-2-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-5-(difluoromethoxy)-N-ethyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 158927185 |
| Molecular Formula | C19H24F2N2O2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-(cyclohexylmethyl)-5-(difluoromethoxy)-N-ethyl-1H-indole-2-carboxamide |
| SMILES | CCN(CC1CCCCC1)C(=O)c1cc2cc(OC(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C19H24F2N2O2/c1-2-23(12-13-6-4-3-5-7-13)18(24)17-11-14-10-15(25-19(20)21)8-9-16(14)22-17/h8-11,13,19,22H,2-7,12H2,1H3 |
| InChIKey | RFPCNYLCHFYKSS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |