C46H82O10 — CID 158928283
tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylprop-2-enoxy)-2-oxo-8-propyloxecan-3-yl]acetate;tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylpropoxy)-2-oxo-8-propyloxecan-3-yl]acetate (PubChem CID 158928283) has the molecular formula C46H82O10 and a molecular weight of 795.15 g/mol. Its IUPAC name is tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylprop-2-enoxy)-2-oxo-8-propyloxecan-3-yl]acetate;tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylpropoxy)-2-oxo-8-propyloxecan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylprop-2-enoxy)-2-oxo-8-propyloxecan-3-yl]acetate;tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylpropoxy)-2-oxo-8-propyloxecan-3-yl]acetate |
|---|---|
| PubChem CID | 158928283 |
| Molecular Formula | C46H82O10 |
| Molecular Weight | 795.15 g/mol |
| Exact Mass | 794.59 |
| IUPAC Name | tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylprop-2-enoxy)-2-oxo-8-propyloxecan-3-yl]acetate;tert-butyl 2-[(3R,8S,9R,10S)-10-methyl-9-(2-methylpropoxy)-2-oxo-8-propyloxecan-3-yl]acetate |
| SMILES | C=C(C)CO[C@@H]1[C@@H](CCC)CCCC[C@H](CC(=O)OC(C)(C)C)C(=O)O[C@H]1C.CCC[C@H]1CCCC[C@H](CC(=O)OC(C)(C)C)C(=O)O[C@@H](C)[C@@H]1OCC(C)C |
| InChI | InChI=1S/C23H42O5.C23H40O5/c2*1-8-11-18-12-9-10-13-19(14-20(24)28-23(5,6)7)22(25)27-17(4)21(18)26-15-16(2)3/h16-19,21H,8-15H2,1-7H3;17-19,21H,2,8-15H2,1,3-7H3/t2*17-,18-,19+,21-/m00/s1 |
| InChIKey | JISHNKDZFPXODS-XNOCZSRPSA-N |
| XLogP | 10.52 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.15 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|