C13H15IN2O2 — CID 158940843
tert-butyl 2-(2-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)acetate (PubChem CID 158940843) has the molecular formula C13H15IN2O2 and a molecular weight of 358.18 g/mol. Its IUPAC name is tert-butyl 2-(2-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)acetate.
| Compound Name | tert-butyl 2-(2-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 158940843 |
| Molecular Formula | C13H15IN2O2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | tert-butyl 2-(2-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cc1cnc2[nH]c(I)cc2c1 |
| InChI | InChI=1S/C13H15IN2O2/c1-13(2,3)18-11(17)5-8-4-9-6-10(14)16-12(9)15-7-8/h4,6-7H,5H2,1-3H3,(H,15,16) |
| InChIKey | VVWPAJYBWYRWDX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|