C22H17FN2O4 — CID 158940868
(E)-3-[2-(3-fluorophenoxy)-5-(2-oxo-2-pyridin-3-ylethyl)phenyl]-N-hydroxyprop-2-enamide (PubChem CID 158940868) has the molecular formula C22H17FN2O4 and a molecular weight of 392.39 g/mol. Its IUPAC name is (E)-3-[2-(3-fluorophenoxy)-5-(2-oxo-2-pyridin-3-ylethyl)phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-(3-fluorophenoxy)-5-(2-oxo-2-pyridin-3-ylethyl)phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 158940868 |
| Molecular Formula | C22H17FN2O4 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (E)-3-[2-(3-fluorophenoxy)-5-(2-oxo-2-pyridin-3-ylethyl)phenyl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1cc(CC(=O)c2cccnc2)ccc1Oc1cccc(F)c1)NO |
| InChI | InChI=1S/C22H17FN2O4/c23-18-4-1-5-19(13-18)29-21-8-6-15(11-16(21)7-9-22(27)25-28)12-20(26)17-3-2-10-24-14-17/h1-11,13-14,28H,12H2,(H,25,27)/b9-7+ |
| InChIKey | JKFOEKKCSPONIA-VQHVLOKHSA-N |
| XLogP | 3.96 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|