C21H18FN3O3 — CID 71621223
(E)-3-[2-(4-fluorophenoxy)-5-[methyl(pyridin-3-yl)amino]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 71621223) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is (E)-3-[2-(4-fluorophenoxy)-5-[methyl(pyridin-3-yl)amino]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[2-(4-fluorophenoxy)-5-[methyl(pyridin-3-yl)amino]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 71621223 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (E)-3-[2-(4-fluorophenoxy)-5-[methyl(pyridin-3-yl)amino]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CN(c1cccnc1)c1ccc(Oc2ccc(F)cc2)c(/C=C/C(=O)NO)c1 |
| InChI | InChI=1S/C21H18FN3O3/c1-25(18-3-2-12-23-14-18)17-7-10-20(15(13-17)4-11-21(26)24-27)28-19-8-5-16(22)6-9-19/h2-14,27H,1H3,(H,24,26)/b11-4+ |
| InChIKey | LCZQQWGWEIAWRM-NYYWCZLTSA-N |
| XLogP | 4.30 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|