About iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide
iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide (PubChem CID 158947116) has the molecular formula C8H14I2N2
and a molecular weight of 392.02 g/mol. Its IUPAC name is iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide.
Molecular Properties
| Compound Name | iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide |
| PubChem CID | 158947116 |
| Molecular Formula | C8H14I2N2 |
| Molecular Weight | 392.02 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide |
| SMILES | CI.C[n+]1ccccc1CN.[I-] |
| InChI | InChI=1S/C7H11N2.CH3I.HI/c1-9-5-3-2-4-7(9)6-8;1-2;/h2-5H,6,8H2,1H3;1H3;1H/q+1;;/p-1 |
| InChIKey | ROBBGLMLAWGKHX-UHFFFAOYSA-M |
| XLogP | -1.98 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.02 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide?
The IUPAC name of iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide (CID 158947116) is iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide.
What is the SMILES notation for iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide?
The canonical SMILES for iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide is CI.C[n+]1ccccc1CN.[I-].
What is the InChIKey of iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide?
The InChIKey is ROBBGLMLAWGKHX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H11N2.CH3I.HI/c1-9-5-3-2-4-7(9)6-8;1-2;/h2-5H,6,8H2,1H3;1H3;1H/q+1;;/p-1.
What are the key properties of iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide?
iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide has a molecular weight of 392.02 g/mol, XLogP of -1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethane;(1-methylpyridin-1-ium-2-yl)methanamine;iodide is sourced from PubChem (CID 158947116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).