About bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane
bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane (PubChem CID 90993522) has the molecular formula C37H60N6+6
and a molecular weight of 588.93 g/mol. Its IUPAC name is bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane.
Molecular Properties
| Compound Name | bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane |
| PubChem CID | 90993522 |
| Molecular Formula | C37H60N6+6 |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.48 |
| IUPAC Name | bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane |
| SMILES | CCCCC.C[n+]1ccccc1C[N+](C)(C)Cc1cccc[n+]1C.C[n+]1ccccc1C[N+](C)(C)Cc1cccc[n+]1C |
| InChI | InChI=1S/2C16H24N3.C5H12/c2*1-17-11-7-5-9-15(17)13-19(3,4)14-16-10-6-8-12-18(16)2;1-3-5-4-2/h2*5-12H,13-14H2,1-4H3;3-5H2,1-2H3/q2*+3; |
| InChIKey | WGJUAUUNLZNYPY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane?
The IUPAC name of bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane (CID 90993522) is bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane.
What is the SMILES notation for bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane?
The canonical SMILES for bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane is CCCCC.C[n+]1ccccc1C[N+](C)(C)Cc1cccc[n+]1C.C[n+]1ccccc1C[N+](C)(C)Cc1cccc[n+]1C.
What is the InChIKey of bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane?
The InChIKey is WGJUAUUNLZNYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H24N3.C5H12/c2*1-17-11-7-5-9-15(17)13-19(3,4)14-16-10-6-8-12-18(16)2;1-3-5-4-2/h2*5-12H,13-14H2,1-4H3;3-5H2,1-2H3/q2*+3;.
What are the key properties of bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane?
bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane has a molecular weight of 588.93 g/mol, XLogP of 4.42, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dimethyl-bis[(1-methylpyridin-1-ium-2-yl)methyl]azanium);pentane is sourced from PubChem (CID 90993522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).