C17H37N3O4 — CID 158950751
methane;2-methyl-N-[1-[3-[2-[3-(methylamino)propoxy]ethoxy]propylamino]-1-oxopropan-2-yl]propanamide (PubChem CID 158950751) has the molecular formula C17H37N3O4 and a molecular weight of 347.50 g/mol. Its IUPAC name is methane;2-methyl-N-[1-[3-[2-[3-(methylamino)propoxy]ethoxy]propylamino]-1-oxopropan-2-yl]propanamide.
| Compound Name | methane;2-methyl-N-[1-[3-[2-[3-(methylamino)propoxy]ethoxy]propylamino]-1-oxopropan-2-yl]propanamide |
|---|---|
| PubChem CID | 158950751 |
| Molecular Formula | C17H37N3O4 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | methane;2-methyl-N-[1-[3-[2-[3-(methylamino)propoxy]ethoxy]propylamino]-1-oxopropan-2-yl]propanamide |
| SMILES | C.CNCCCOCCOCCCNC(=O)C(C)NC(=O)C(C)C |
| InChI | InChI=1S/C16H33N3O4.CH4/c1-13(2)15(20)19-14(3)16(21)18-8-6-10-23-12-11-22-9-5-7-17-4;/h13-14,17H,5-12H2,1-4H3,(H,18,21)(H,19,20);1H4 |
| InChIKey | JLJXAUAPZZLDKT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|