C18H21ClN2O5 — CID 158952249
ethyl 6-chloro-5-methylpyridine-3-carboxylate;ethyl 5-methyl-6-oxo-1H-pyridine-3-carboxylate (PubChem CID 158952249) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is ethyl 6-chloro-5-methylpyridine-3-carboxylate;ethyl 5-methyl-6-oxo-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-5-methylpyridine-3-carboxylate;ethyl 5-methyl-6-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158952249 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | ethyl 6-chloro-5-methylpyridine-3-carboxylate;ethyl 5-methyl-6-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c(=O)c(C)c1.CCOC(=O)c1cnc(Cl)c(C)c1 |
| InChI | InChI=1S/C9H10ClNO2.C9H11NO3/c1-3-13-9(12)7-4-6(2)8(10)11-5-7;1-3-13-9(12)7-4-6(2)8(11)10-5-7/h4-5H,3H2,1-2H3;4-5H,3H2,1-2H3,(H,10,11) |
| InChIKey | JLOPKDIOELLZOM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|