C33H36F2N4O2 — CID 158954833
3,5-dideuterio-N-[6-[(4-deuterio-3,5-difluorophenyl)methyl]-3H-isoindol-1-yl]-4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-(oxan-4-ylmethyl)benzamide (PubChem CID 158954833) has the molecular formula C33H36F2N4O2 and a molecular weight of 569.74 g/mol. Its IUPAC name is 3,5-dideuterio-N-[6-[(4-deuterio-3,5-difluorophenyl)methyl]-3H-isoindol-1-yl]-4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-(oxan-4-ylmethyl)benzamide.
| Compound Name | 3,5-dideuterio-N-[6-[(4-deuterio-3,5-difluorophenyl)methyl]-3H-isoindol-1-yl]-4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-(oxan-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 158954833 |
| Molecular Formula | C33H36F2N4O2 |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.35 |
| IUPAC Name | 3,5-dideuterio-N-[6-[(4-deuterio-3,5-difluorophenyl)methyl]-3H-isoindol-1-yl]-4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-(oxan-4-ylmethyl)benzamide |
| SMILES | [2H]c1cc(C(=O)NC2=NCc3ccc(Cc4cc(F)c([2H])c(F)c4)cc32)c(CC2CCOCC2)c([2H])c1N1C([2H])([2H])C([2H])([2H])N(C)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C33H36F2N4O2/c1-38-8-10-39(11-9-38)29-4-5-30(26(19-29)15-22-6-12-41-13-7-22)33(40)37-32-31-18-23(2-3-25(31)21-36-32)14-24-16-27(34)20-28(35)17-24/h2-5,16-20,22H,6-15,21H2,1H3,(H,36,37,40)/i4D,8D2,9D2,10D2,11D2,19D,20D |
| InChIKey | JITMWVXJOXVLNV-HAJDWVFTSA-N |
| XLogP | 4.97 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |