C34H39FN4O2 — CID 159388339
3,5-dideuterio-N-[6-[(3-fluoro-5-methylphenyl)methyl]-3H-isoindol-1-yl]-4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)methyl]benzamide (PubChem CID 159388339) has the molecular formula C34H39FN4O2 and a molecular weight of 560.75 g/mol. Its IUPAC name is 3,5-dideuterio-N-[6-[(3-fluoro-5-methylphenyl)methyl]-3H-isoindol-1-yl]-4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)methyl]benzamide.
| Compound Name | 3,5-dideuterio-N-[6-[(3-fluoro-5-methylphenyl)methyl]-3H-isoindol-1-yl]-4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 159388339 |
| Molecular Formula | C34H39FN4O2 |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | 3,5-dideuterio-N-[6-[(3-fluoro-5-methylphenyl)methyl]-3H-isoindol-1-yl]-4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)methyl]benzamide |
| SMILES | [2H]c1cc(C(=O)NC2=NCc3ccc(Cc4cc(C)cc(F)c4)cc32)c(CC2CC([2H])([2H])OC([2H])([2H])C2)c([2H])c1N1CCN(C)CC1 |
| InChI | InChI=1S/C34H39FN4O2/c1-23-15-26(19-29(35)16-23)17-25-3-4-27-22-36-33(32(27)20-25)37-34(40)31-6-5-30(39-11-9-38(2)10-12-39)21-28(31)18-24-7-13-41-14-8-24/h3-6,15-16,19-21,24H,7-14,17-18,22H2,1-2H3,(H,36,37,40)/i5D,13D2,14D2,21D |
| InChIKey | GSOHOEXUKGIVGU-TWNSGSSJSA-N |
| XLogP | 5.14 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |