C12H15FN2O7P+ — CID 158956742
[(1R,3R,4S,7R)-4-fluoro-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium (PubChem CID 158956742) has the molecular formula C12H15FN2O7P+ and a molecular weight of 349.23 g/mol. Its IUPAC name is [(1R,3R,4S,7R)-4-fluoro-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium.
| Compound Name | [(1R,3R,4S,7R)-4-fluoro-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 158956742 |
| Molecular Formula | C12H15FN2O7P+ |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | [(1R,3R,4S,7R)-4-fluoro-7-hydroxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
| SMILES | Cc1cn([C@@H]2O[C@@]3(CO[P+](C)=O)CO[C@]2(F)[C@@H]3O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14FN2O7P/c1-6-3-15(10(18)14-7(6)16)9-12(13)8(17)11(22-9,4-20-12)5-21-23(2)19/h3,8-9,17H,4-5H2,1-2H3/p+1/t8-,9-,11-,12-/m1/s1 |
| InChIKey | DTHHVFFHUMHOPV-CNVPUSNMSA-O |
| XLogP | -0.44 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|