C23H26ClNO3 — CID 158957752
1-[2-[(4-ethoxyphenyl)methyl]-1-benzofuran-3-yl]-2-pyrrolidin-1-ylethanone;hydrochloride (PubChem CID 158957752) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is 1-[2-[(4-ethoxyphenyl)methyl]-1-benzofuran-3-yl]-2-pyrrolidin-1-ylethanone;hydrochloride.
| Compound Name | 1-[2-[(4-ethoxyphenyl)methyl]-1-benzofuran-3-yl]-2-pyrrolidin-1-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 158957752 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-[2-[(4-ethoxyphenyl)methyl]-1-benzofuran-3-yl]-2-pyrrolidin-1-ylethanone;hydrochloride |
| SMILES | CCOc1ccc(Cc2oc3ccccc3c2C(=O)CN2CCCC2)cc1.Cl |
| InChI | InChI=1S/C23H25NO3.ClH/c1-2-26-18-11-9-17(10-12-18)15-22-23(19-7-3-4-8-21(19)27-22)20(25)16-24-13-5-6-14-24;/h3-4,7-12H,2,5-6,13-16H2,1H3;1H |
| InChIKey | JMFMMQRQUBQXEN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |