C16H28Na2O11S2 — CID 158961702
disodium;[2-[5-ethyl-4-methyl-2-(sulfonatooxymethyl)oxolan-3-yl]oxy-3,5,6-trimethyloxan-4-yl] sulfate (PubChem CID 158961702) has the molecular formula C16H28Na2O11S2 and a molecular weight of 506.50 g/mol. Its IUPAC name is disodium;[2-[5-ethyl-4-methyl-2-(sulfonatooxymethyl)oxolan-3-yl]oxy-3,5,6-trimethyloxan-4-yl] sulfate.
| Compound Name | disodium;[2-[5-ethyl-4-methyl-2-(sulfonatooxymethyl)oxolan-3-yl]oxy-3,5,6-trimethyloxan-4-yl] sulfate |
|---|---|
| PubChem CID | 158961702 |
| Molecular Formula | C16H28Na2O11S2 |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | disodium;[2-[5-ethyl-4-methyl-2-(sulfonatooxymethyl)oxolan-3-yl]oxy-3,5,6-trimethyloxan-4-yl] sulfate |
| SMILES | CCC1OC(COS(=O)(=O)[O-])C(OC2OC(C)C(C)C(OS(=O)(=O)[O-])C2C)C1C.[Na+].[Na+] |
| InChI | InChI=1S/C16H30O11S2.2Na/c1-6-12-9(3)15(13(25-12)7-23-28(17,18)19)26-16-10(4)14(27-29(20,21)22)8(2)11(5)24-16;;/h8-16H,6-7H2,1-5H3,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2 |
| InChIKey | MCFBZEXEOITDRG-UHFFFAOYSA-L |
| XLogP | -5.47 |
| TPSA | 160.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|