C27H35B2N2O11 — CID 158962329
CID 158962329 (PubChem CID 158962329) has the molecular formula C27H35B2N2O11 and a molecular weight of 585.20 g/mol.
| Compound Name | CID 158962329 |
|---|---|
| PubChem CID | 158962329 |
| Molecular Formula | C27H35B2N2O11 |
| Molecular Weight | 585.20 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccc(O)cc2CC1C(=O)O.C[B]OOCB=O.O=C(O)C1Cc2cc(O)ccc2CN1 |
| InChI | InChI=1S/C15H19NO5.C10H11NO3.C2H5B2O3/c1-15(2,3)21-14(20)16-8-9-4-5-11(17)6-10(9)7-12(16)13(18)19;12-8-2-1-6-5-11-9(10(13)14)4-7(6)3-8;1-3-7-6-2-4-5/h4-6,12,17H,7-8H2,1-3H3,(H,18,19);1-3,9,11-12H,4-5H2,(H,13,14);2H2,1H3 |
| InChIKey | WVDJPQIJCRXDHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|