C17H16BrFN2O3-2 — CID 158962444
(4-bromophenyl)-[[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]amino]methanediolate (PubChem CID 158962444) has the molecular formula C17H16BrFN2O3-2 and a molecular weight of 395.23 g/mol. Its IUPAC name is (4-bromophenyl)-[[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]amino]methanediolate.
| Compound Name | (4-bromophenyl)-[[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]amino]methanediolate |
|---|---|
| PubChem CID | 158962444 |
| Molecular Formula | C17H16BrFN2O3-2 |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (4-bromophenyl)-[[3-[(4-fluorophenyl)methylamino]-3-oxopropyl]amino]methanediolate |
| SMILES | O=C(CCNC([O-])([O-])c1ccc(Br)cc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16BrFN2O3/c18-14-5-3-13(4-6-14)17(23,24)21-10-9-16(22)20-11-12-1-7-15(19)8-2-12/h1-8,21H,9-11H2,(H,20,22)/q-2 |
| InChIKey | JMUDLLRJQNZQGC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|