C18H19FN2O3-2 — CID 160663584
(4-fluorophenyl)-[[3-oxo-3-(2-phenylethylamino)propyl]amino]methanediolate (PubChem CID 160663584) has the molecular formula C18H19FN2O3-2 and a molecular weight of 330.36 g/mol. Its IUPAC name is (4-fluorophenyl)-[[3-oxo-3-(2-phenylethylamino)propyl]amino]methanediolate.
| Compound Name | (4-fluorophenyl)-[[3-oxo-3-(2-phenylethylamino)propyl]amino]methanediolate |
|---|---|
| PubChem CID | 160663584 |
| Molecular Formula | C18H19FN2O3-2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (4-fluorophenyl)-[[3-oxo-3-(2-phenylethylamino)propyl]amino]methanediolate |
| SMILES | O=C(CCNC([O-])([O-])c1ccc(F)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C18H19FN2O3/c19-16-8-6-15(7-9-16)18(23,24)21-13-11-17(22)20-12-10-14-4-2-1-3-5-14/h1-9,21H,10-13H2,(H,20,22)/q-2 |
| InChIKey | RLZNDKYYIDPGAM-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|