C18H19FN2O3S-2 — CID 59286470
amino-[4-[2-[[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]ethyl]phenyl]methanediolate (PubChem CID 59286470) has the molecular formula C18H19FN2O3S-2 and a molecular weight of 362.43 g/mol. Its IUPAC name is amino-[4-[2-[[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]ethyl]phenyl]methanediolate.
| Compound Name | amino-[4-[2-[[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]ethyl]phenyl]methanediolate |
|---|---|
| PubChem CID | 59286470 |
| Molecular Formula | C18H19FN2O3S-2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | amino-[4-[2-[[2-[(4-fluorophenyl)methylsulfanyl]acetyl]amino]ethyl]phenyl]methanediolate |
| SMILES | NC([O-])([O-])c1ccc(CCNC(=O)CSCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN2O3S/c19-16-7-3-14(4-8-16)11-25-12-17(22)21-10-9-13-1-5-15(6-2-13)18(20,23)24/h1-8H,9-12,20H2,(H,21,22)/q-2 |
| InChIKey | RPLHVWULTGZURT-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|