C29H28N4O4 — CID 158962693
2-diazo-4-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxo-N-phenylbutanamide;methane (PubChem CID 158962693) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 2-diazo-4-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxo-N-phenylbutanamide;methane.
| Compound Name | 2-diazo-4-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxo-N-phenylbutanamide;methane |
|---|---|
| PubChem CID | 158962693 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-diazo-4-[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxo-N-phenylbutanamide;methane |
| SMILES | C.Cc1oc(-c2ccccc2)nc1CCOc1cccc(CC(=O)C(=[N+]=[N-])C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C28H24N4O4.CH4/c1-19-24(31-28(36-19)21-10-4-2-5-11-21)15-16-35-23-14-8-9-20(17-23)18-25(33)26(32-29)27(34)30-22-12-6-3-7-13-22;/h2-14,17H,15-16,18H2,1H3,(H,30,34);1H4 |
| InChIKey | JMUXYNYOSOMWCG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|