C12H22O10 — CID 158964841
ethane-1,1-diol;2-formyloxyacetic acid;1-methoxyethyl 3-oxobutanoate (PubChem CID 158964841) has the molecular formula C12H22O10 and a molecular weight of 326.30 g/mol. Its IUPAC name is ethane-1,1-diol;2-formyloxyacetic acid;1-methoxyethyl 3-oxobutanoate.
| Compound Name | ethane-1,1-diol;2-formyloxyacetic acid;1-methoxyethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 158964841 |
| Molecular Formula | C12H22O10 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | ethane-1,1-diol;2-formyloxyacetic acid;1-methoxyethyl 3-oxobutanoate |
| SMILES | CC(O)O.COC(C)OC(=O)CC(C)=O.O=COCC(=O)O |
| InChI | InChI=1S/C7H12O4.C3H4O4.C2H6O2/c1-5(8)4-7(9)11-6(2)10-3;4-2-7-1-3(5)6;1-2(3)4/h6H,4H2,1-3H3;2H,1H2,(H,5,6);2-4H,1H3 |
| InChIKey | JNBLMCKWXOUKEH-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|