C41H22N6O12 — CID 158967048
(6-nitro-3-pyridinyl) 2-[4-[[4-[5-[(6-nitro-3-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]methyl]phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 158967048) has the molecular formula C41H22N6O12 and a molecular weight of 790.66 g/mol. Its IUPAC name is (6-nitro-3-pyridinyl) 2-[4-[[4-[5-[(6-nitro-3-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]methyl]phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (6-nitro-3-pyridinyl) 2-[4-[[4-[5-[(6-nitro-3-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]methyl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 158967048 |
| Molecular Formula | C41H22N6O12 |
| Molecular Weight | 790.66 g/mol |
| Exact Mass | 790.13 |
| IUPAC Name | (6-nitro-3-pyridinyl) 2-[4-[[4-[5-[(6-nitro-3-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]phenyl]methyl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])nc1)c1ccc2c(c1)C(=O)N(c1ccc(Cc3ccc(N4C(=O)c5ccc(C(=O)Oc6ccc([N+](=O)[O-])nc6)cc5C4=O)cc3)cc1)C2=O |
| InChI | InChI=1S/C41H22N6O12/c48-36-30-13-5-24(40(52)58-28-11-15-34(42-20-28)46(54)55)18-32(30)38(50)44(36)26-7-1-22(2-8-26)17-23-3-9-27(10-4-23)45-37(49)31-14-6-25(19-33(31)39(45)51)41(53)59-29-12-16-35(43-21-29)47(56)57/h1-16,18-21H,17H2 |
| InChIKey | RUDVRZCJOLIQKE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 239.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|