C42H21F3N6O12 — CID 158861323
(5-nitro-2-pyridinyl) 2-[3-methyl-4-[4-[5-[(5-nitro-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]-2-(trifluoromethyl)phenyl]phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 158861323) has the molecular formula C42H21F3N6O12 and a molecular weight of 858.65 g/mol. Its IUPAC name is (5-nitro-2-pyridinyl) 2-[3-methyl-4-[4-[5-[(5-nitro-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]-2-(trifluoromethyl)phenyl]phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (5-nitro-2-pyridinyl) 2-[3-methyl-4-[4-[5-[(5-nitro-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]-2-(trifluoromethyl)phenyl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 158861323 |
| Molecular Formula | C42H21F3N6O12 |
| Molecular Weight | 858.65 g/mol |
| Exact Mass | 858.12 |
| IUPAC Name | (5-nitro-2-pyridinyl) 2-[3-methyl-4-[4-[5-[(5-nitro-2-pyridinyl)oxycarbonyl]-1,3-dioxoisoindol-2-yl]-2-(trifluoromethyl)phenyl]phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cc(N2C(=O)c3ccc(C(=O)Oc4ccc([N+](=O)[O-])cn4)cc3C2=O)ccc1-c1ccc(N2C(=O)c3ccc(C(=O)Oc4ccc([N+](=O)[O-])cn4)cc3C2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C42H21F3N6O12/c1-20-14-23(48-36(52)29-8-2-21(15-31(29)38(48)54)40(56)62-34-12-6-25(18-46-34)50(58)59)4-10-27(20)28-11-5-24(17-33(28)42(43,44)45)49-37(53)30-9-3-22(16-32(30)39(49)55)41(57)63-35-13-7-26(19-47-35)51(60)61/h2-19H,1H3 |
| InChIKey | HKQNBWRIYITKLK-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 239.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|