About hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron (PubChem CID 158967900) has the molecular formula H2Cr2FeO7
and a molecular weight of 273.85 g/mol. Its IUPAC name is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron.
Molecular Properties
| Compound Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron |
| PubChem CID | 158967900 |
| Molecular Formula | H2Cr2FeO7 |
| Molecular Weight | 273.85 g/mol |
| Exact Mass | 273.80 |
| IUPAC Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron |
| SMILES | O=[Cr](=O)(O)O[Cr](=O)(=O)O.[Fe] |
| InChI | InChI=1S/2Cr.Fe.2H2O.5O/h;;;2*1H2;;;;;/q2*+1;;;;;;;;/p-2 |
| InChIKey | JNLBNEPNDLZEFW-UHFFFAOYSA-L |
| XLogP | -1.67 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.85 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron?
The IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron (CID 158967900) is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron.
What is the SMILES notation for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron?
The canonical SMILES for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron is O=[Cr](=O)(O)O[Cr](=O)(=O)O.[Fe].
What is the InChIKey of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron?
The InChIKey is JNLBNEPNDLZEFW-UHFFFAOYSA-L. The full InChI is InChI=1S/2Cr.Fe.2H2O.5O/h;;;2*1H2;;;;;/q2*+1;;;;;;;;/p-2.
What are the key properties of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron?
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron has a molecular weight of 273.85 g/mol, XLogP of -1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;iron is sourced from PubChem (CID 158967900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).