C28H52N2O9 — CID 158970361
ethyl (E)-5-methylhex-2-enoate;ethyl 5-methyl-3-(nitromethyl)hexanoate;6-methyl-4-(nitromethyl)heptan-2-one (PubChem CID 158970361) has the molecular formula C28H52N2O9 and a molecular weight of 560.73 g/mol. Its IUPAC name is ethyl (E)-5-methylhex-2-enoate;ethyl 5-methyl-3-(nitromethyl)hexanoate;6-methyl-4-(nitromethyl)heptan-2-one.
| Compound Name | ethyl (E)-5-methylhex-2-enoate;ethyl 5-methyl-3-(nitromethyl)hexanoate;6-methyl-4-(nitromethyl)heptan-2-one |
|---|---|
| PubChem CID | 158970361 |
| Molecular Formula | C28H52N2O9 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | ethyl (E)-5-methylhex-2-enoate;ethyl 5-methyl-3-(nitromethyl)hexanoate;6-methyl-4-(nitromethyl)heptan-2-one |
| SMILES | CC(=O)CC(CC(C)C)C[N+](=O)[O-].CCOC(=O)/C=C/CC(C)C.CCOC(=O)CC(CC(C)C)C[N+](=O)[O-] |
| InChI | InChI=1S/C10H19NO4.C9H17NO3.C9H16O2/c1-4-15-10(12)6-9(5-8(2)3)7-11(13)14;1-7(2)4-9(5-8(3)11)6-10(12)13;1-4-11-9(10)7-5-6-8(2)3/h8-9H,4-7H2,1-3H3;7,9H,4-6H2,1-3H3;5,7-8H,4,6H2,1-3H3/b;;7-5+ |
| InChIKey | JNSRZMCCUYBMLX-AWHULUMYSA-N |
| XLogP | 5.93 |
| TPSA | 155.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|