C18H27NO6 — CID 102052618
ethyl (4S,5R)-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-5-(2-methylpropyl)-4-nitrocyclopentene-1-carboxylate (PubChem CID 102052618) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl (4S,5R)-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-5-(2-methylpropyl)-4-nitrocyclopentene-1-carboxylate.
| Compound Name | ethyl (4S,5R)-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-5-(2-methylpropyl)-4-nitrocyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 102052618 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | ethyl (4S,5R)-4-[(E)-4-ethoxy-4-oxobut-2-enyl]-5-(2-methylpropyl)-4-nitrocyclopentene-1-carboxylate |
| SMILES | CCOC(=O)/C=C/C[C@]1([N+](=O)[O-])CC=C(C(=O)OCC)[C@H]1CC(C)C |
| InChI | InChI=1S/C18H27NO6/c1-5-24-16(20)8-7-10-18(19(22)23)11-9-14(17(21)25-6-2)15(18)12-13(3)4/h7-9,13,15H,5-6,10-12H2,1-4H3/b8-7+/t15-,18+/m1/s1 |
| InChIKey | KLYRXVQZNVMWHC-ZIEDNJRCSA-N |
| XLogP | 3.07 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|