C15H15F2N3O6 — CID 158973677
2,4-difluoro-1-nitrobenzene;3-(2-methoxyethoxy)-4-nitroaniline (PubChem CID 158973677) has the molecular formula C15H15F2N3O6 and a molecular weight of 371.30 g/mol. Its IUPAC name is 2,4-difluoro-1-nitrobenzene;3-(2-methoxyethoxy)-4-nitroaniline.
| Compound Name | 2,4-difluoro-1-nitrobenzene;3-(2-methoxyethoxy)-4-nitroaniline |
|---|---|
| PubChem CID | 158973677 |
| Molecular Formula | C15H15F2N3O6 |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2,4-difluoro-1-nitrobenzene;3-(2-methoxyethoxy)-4-nitroaniline |
| SMILES | COCCOc1cc(N)ccc1[N+](=O)[O-].O=[N+]([O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C9H12N2O4.C6H3F2NO2/c1-14-4-5-15-9-6-7(10)2-3-8(9)11(12)13;7-4-1-2-6(9(10)11)5(8)3-4/h2-3,6H,4-5,10H2,1H3;1-3H |
| InChIKey | JOCUMSPBKVQXQJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|