C16H22O2 — CID 158976326
1,5-diethyl-2,4-bis(prop-2-enoxy)benzene (PubChem CID 158976326) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1,5-diethyl-2,4-bis(prop-2-enoxy)benzene.
| Compound Name | 1,5-diethyl-2,4-bis(prop-2-enoxy)benzene |
|---|---|
| PubChem CID | 158976326 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1,5-diethyl-2,4-bis(prop-2-enoxy)benzene |
| SMILES | C=CCOc1cc(OCC=C)c(CC)cc1CC |
| InChI | InChI=1S/C16H22O2/c1-5-9-17-15-12-16(18-10-6-2)14(8-4)11-13(15)7-3/h5-6,11-12H,1-2,7-10H2,3-4H3 |
| InChIKey | IWTPIRURQGEESN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|