C30H32N2O3 — CID 158977505
N-benzhydrylformamide;diphenylmethanamine;ethyl formate (PubChem CID 158977505) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-benzhydrylformamide;diphenylmethanamine;ethyl formate.
| Compound Name | N-benzhydrylformamide;diphenylmethanamine;ethyl formate |
|---|---|
| PubChem CID | 158977505 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-benzhydrylformamide;diphenylmethanamine;ethyl formate |
| SMILES | CCOC=O.NC(c1ccccc1)c1ccccc1.O=CNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13NO.C13H13N.C3H6O2/c16-11-15-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-5-3-4/h1-11,14H,(H,15,16);1-10,13H,14H2;3H,2H2,1H3 |
| InChIKey | JOOQJENEIKZVES-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|