C32H29N3Si — CID 158985368
dimethyl-(4-methyl-2-pyridinyl)-[3-[9-(5-methyl-2-pyridinyl)carbazol-2-yl]phenyl]silane (PubChem CID 158985368) has the molecular formula C32H29N3Si and a molecular weight of 483.69 g/mol. Its IUPAC name is dimethyl-(4-methyl-2-pyridinyl)-[3-[9-(5-methyl-2-pyridinyl)carbazol-2-yl]phenyl]silane.
| Compound Name | dimethyl-(4-methyl-2-pyridinyl)-[3-[9-(5-methyl-2-pyridinyl)carbazol-2-yl]phenyl]silane |
|---|---|
| PubChem CID | 158985368 |
| Molecular Formula | C32H29N3Si |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | dimethyl-(4-methyl-2-pyridinyl)-[3-[9-(5-methyl-2-pyridinyl)carbazol-2-yl]phenyl]silane |
| SMILES | Cc1ccc(-n2c3ccccc3c3ccc(-c4cccc([Si](C)(C)c5cc(C)ccn5)c4)cc32)nc1 |
| InChI | InChI=1S/C32H29N3Si/c1-22-16-17-33-32(18-22)36(3,4)26-9-7-8-24(19-26)25-13-14-28-27-10-5-6-11-29(27)35(30(28)20-25)31-15-12-23(2)21-34-31/h5-21H,1-4H3 |
| InChIKey | GANZZPGMHPKMEB-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|