About [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate
[4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate (PubChem CID 15898609) has the molecular formula C28H29NO3
and a molecular weight of 427.54 g/mol. Its IUPAC name is [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate.
Molecular Properties
| Compound Name | [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate |
| PubChem CID | 15898609 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate |
| SMILES | [C-]#[N+]c1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H29NO3/c1-3-4-5-6-7-8-21-31-26-17-11-22(12-18-26)23-13-19-27(20-14-23)32-28(30)24-9-15-25(29-2)16-10-24/h9-20H,3-8,21H2,1H3 |
| InChIKey | CNAPHWSDUHPTSQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 39.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate?
The IUPAC name of [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate (CID 15898609) is [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate.
What is the SMILES notation for [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate?
The canonical SMILES for [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate is [C-]#[N+]c1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCCCCC)cc3)cc2)cc1.
What is the InChIKey of [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate?
The InChIKey is CNAPHWSDUHPTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO3/c1-3-4-5-6-7-8-21-31-26-17-11-22(12-18-26)23-13-19-27(20-14-23)32-28(30)24-9-15-25(29-2)16-10-24/h9-20H,3-8,21H2,1H3.
What are the key properties of [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate?
[4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate has a molecular weight of 427.54 g/mol, XLogP of 7.86, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-octoxyphenyl)phenyl] 4-isocyanobenzoate is sourced from PubChem (CID 15898609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).