C25H28N2O5S — CID 158989399
(5S)-5-[[4-(2,3-dimethylphenyl)phenoxy]methyl]-4,5-dihydro-1,3-oxazol-2-amine;4-methylbenzenesulfonic acid (PubChem CID 158989399) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is (5S)-5-[[4-(2,3-dimethylphenyl)phenoxy]methyl]-4,5-dihydro-1,3-oxazol-2-amine;4-methylbenzenesulfonic acid.
| Compound Name | (5S)-5-[[4-(2,3-dimethylphenyl)phenoxy]methyl]-4,5-dihydro-1,3-oxazol-2-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 158989399 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (5S)-5-[[4-(2,3-dimethylphenyl)phenoxy]methyl]-4,5-dihydro-1,3-oxazol-2-amine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1cccc(-c2ccc(OC[C@@H]3CN=C(N)O3)cc2)c1C |
| InChI | InChI=1S/C18H20N2O2.C7H8O3S/c1-12-4-3-5-17(13(12)2)14-6-8-15(9-7-14)21-11-16-10-20-18(19)22-16;1-6-2-4-7(5-3-6)11(8,9)10/h3-9,16H,10-11H2,1-2H3,(H2,19,20);2-5H,1H3,(H,8,9,10)/t16-;/m0./s1 |
| InChIKey | JPYZUROUAQWONU-NTISSMGPSA-N |
| XLogP | 4.30 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|