C22H26BBr2IN8O2 — CID 158996601
5-bromo-2-iodopyridine;5-bromo-2-(1-methyltriazol-4-yl)pyridine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole (PubChem CID 158996601) has the molecular formula C22H26BBr2IN8O2 and a molecular weight of 732.03 g/mol. Its IUPAC name is 5-bromo-2-iodopyridine;5-bromo-2-(1-methyltriazol-4-yl)pyridine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole.
| Compound Name | 5-bromo-2-iodopyridine;5-bromo-2-(1-methyltriazol-4-yl)pyridine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
|---|---|
| PubChem CID | 158996601 |
| Molecular Formula | C22H26BBr2IN8O2 |
| Molecular Weight | 732.03 g/mol |
| Exact Mass | 729.97 |
| IUPAC Name | 5-bromo-2-iodopyridine;5-bromo-2-(1-methyltriazol-4-yl)pyridine;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)triazole |
| SMILES | Brc1ccc(I)nc1.Cn1cc(-c2ccc(Br)cn2)nn1.Cn1cc(B2OC(C)(C)C(C)(C)O2)nn1 |
| InChI | InChI=1S/C9H16BN3O2.C8H7BrN4.C5H3BrIN/c1-8(2)9(3,4)15-10(14-8)7-6-13(5)12-11-7;1-13-5-8(11-12-13)7-3-2-6(9)4-10-7;6-4-1-2-5(7)8-3-4/h6H,1-5H3;2-5H,1H3;1-3H |
| InChIKey | JQUVFTZGSFISQI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.03 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|