About ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium
ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium (PubChem CID 159004388) has the molecular formula C13H31NO6P+
and a molecular weight of 328.37 g/mol. Its IUPAC name is ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium.
Molecular Properties
| Compound Name | ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium |
| PubChem CID | 159004388 |
| Molecular Formula | C13H31NO6P+ |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium |
| SMILES | CC(C)(C)OC(=O)OC(C)(C)C.CCN(CC)[P+](O)(O)O |
| InChI | InChI=1S/C9H18O3.C4H13NO3P/c1-8(2,3)11-7(10)12-9(4,5)6;1-3-5(4-2)9(6,7)8/h1-6H3;6-8H,3-4H2,1-2H3/q;+1 |
| InChIKey | RUIMIBBFTHNCQT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium?
The IUPAC name of ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium (CID 159004388) is ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium.
What is the SMILES notation for ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium?
The canonical SMILES for ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium is CC(C)(C)OC(=O)OC(C)(C)C.CCN(CC)[P+](O)(O)O.
What is the InChIKey of ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium?
The InChIKey is RUIMIBBFTHNCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3.C4H13NO3P/c1-8(2,3)11-7(10)12-9(4,5)6;1-3-5(4-2)9(6,7)8/h1-6H3;6-8H,3-4H2,1-2H3/q;+1.
What are the key properties of ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium?
ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium has a molecular weight of 328.37 g/mol, XLogP of 2.72, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl carbonate;diethylamino(trihydroxy)phosphanium is sourced from PubChem (CID 159004388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).