About 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane
2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane (PubChem CID 159006628) has the molecular formula C17H34N6
and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane.
Molecular Properties
| Compound Name | 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane |
| PubChem CID | 159006628 |
| Molecular Formula | C17H34N6 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.28 |
| IUPAC Name | 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane |
| SMILES | CC(C)C.CCn1nccc1N.CCn1nccc1NC(C)C |
| InChI | InChI=1S/C8H15N3.C5H9N3.C4H10/c1-4-11-8(5-6-9-11)10-7(2)3;1-2-8-5(6)3-4-7-8;1-4(2)3/h5-7,10H,4H2,1-3H3;3-4H,2,6H2,1H3;4H,1-3H3 |
| InChIKey | JRZPKNJXGMDHIJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane?
The IUPAC name of 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane (CID 159006628) is 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane.
What is the SMILES notation for 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane?
The canonical SMILES for 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane is CC(C)C.CCn1nccc1N.CCn1nccc1NC(C)C.
What is the InChIKey of 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane?
The InChIKey is JRZPKNJXGMDHIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3.C5H9N3.C4H10/c1-4-11-8(5-6-9-11)10-7(2)3;1-2-8-5(6)3-4-7-8;1-4(2)3/h5-7,10H,4H2,1-3H3;3-4H,2,6H2,1H3;4H,1-3H3.
What are the key properties of 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane?
2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane has a molecular weight of 322.50 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-propan-2-ylpyrazol-3-amine;2-ethylpyrazol-3-amine;2-methylpropane is sourced from PubChem (CID 159006628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).