C7H10N4O2 — CID 130652356
N'-(2-ethylpyrazol-3-yl)oxamide (PubChem CID 130652356) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is N'-(2-ethylpyrazol-3-yl)oxamide.
| Compound Name | N'-(2-ethylpyrazol-3-yl)oxamide |
|---|---|
| PubChem CID | 130652356 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | N'-(2-ethylpyrazol-3-yl)oxamide |
| SMILES | CCn1nccc1NC(=O)C(N)=O |
| InChI | InChI=1S/C7H10N4O2/c1-2-11-5(3-4-9-11)10-7(13)6(8)12/h3-4H,2H2,1H3,(H2,8,12)(H,10,13) |
| InChIKey | CRXQOQJXPRMWSE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|