C32H25N5O — CID 159007785
4-[1-(1,1-dipyridin-2-ylethyl)-3-(2-ethynylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 159007785) has the molecular formula C32H25N5O and a molecular weight of 495.59 g/mol. Its IUPAC name is 4-[1-(1,1-dipyridin-2-ylethyl)-3-(2-ethynylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1-(1,1-dipyridin-2-ylethyl)-3-(2-ethynylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 159007785 |
| Molecular Formula | C32H25N5O |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 4-[1-(1,1-dipyridin-2-ylethyl)-3-(2-ethynylphenyl)pyrrolo[3,2-b]pyridin-6-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | C#Cc1ccccc1-c1cn(C(C)(c2ccccn2)c2ccccn2)c2cc(-c3c(C)noc3C)cnc12 |
| InChI | InChI=1S/C32H25N5O/c1-5-23-12-6-7-13-25(23)26-20-37(27-18-24(19-35-31(26)27)30-21(2)36-38-22(30)3)32(4,28-14-8-10-16-33-28)29-15-9-11-17-34-29/h1,6-20H,2-4H3 |
| InChIKey | JSDCCIORIPIIBS-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|