C29H48N2O9 — CID 159008547
tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-methylpyrrolidine-1-carboxylate;methyl prop-2-enoate (PubChem CID 159008547) has the molecular formula C29H48N2O9 and a molecular weight of 568.71 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-methylpyrrolidine-1-carboxylate;methyl prop-2-enoate.
| Compound Name | tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-methylpyrrolidine-1-carboxylate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 159008547 |
| Molecular Formula | C29H48N2O9 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-[(E)-3-methoxy-3-oxoprop-1-enyl]-4-methylpyrrolidine-1-carboxylate;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.COC(=O)/C=C/[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C.C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C14H23NO4.C11H19NO3.C4H6O2/c1-10-8-15(13(17)19-14(2,3)4)9-11(10)6-7-12(16)18-5;1-8-5-12(6-9(8)7-13)10(14)15-11(2,3)4;1-3-4(5)6-2/h6-7,10-11H,8-9H2,1-5H3;7-9H,5-6H2,1-4H3;3H,1H2,2H3/b7-6+;;/t10-,11-;8-,9+;/m11./s1 |
| InChIKey | JSFLZZQNPHUGGZ-OQGUDGIQSA-N |
| XLogP | 4.25 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|