C23H40N2O5 — CID 159107619
tert-butyl (3S,4S)-3-ethenyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate (PubChem CID 159107619) has the molecular formula C23H40N2O5 and a molecular weight of 424.58 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-ethenyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-ethenyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 159107619 |
| Molecular Formula | C23H40N2O5 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | tert-butyl (3S,4S)-3-ethenyl-4-methylpyrrolidine-1-carboxylate;tert-butyl (3S,4S)-3-formyl-4-methylpyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C.C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C12H21NO2.C11H19NO3/c1-6-10-8-13(7-9(10)2)11(14)15-12(3,4)5;1-8-5-12(6-9(8)7-13)10(14)15-11(2,3)4/h6,9-10H,1,7-8H2,2-5H3;7-9H,5-6H2,1-4H3/t9-,10-;8-,9+/m11/s1 |
| InChIKey | KEBXONBASRRFFD-VOMURUGLSA-N |
| XLogP | 4.36 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|