C12H19NO3 — CID 134946976
tert-butyl (3S,4S)-3-ethenyl-4-formylpyrrolidine-1-carboxylate (PubChem CID 134946976) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-ethenyl-4-formylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-ethenyl-4-formylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134946976 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | tert-butyl (3S,4S)-3-ethenyl-4-formylpyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1CN(C(=O)OC(C)(C)C)C[C@H]1C=O |
| InChI | InChI=1S/C12H19NO3/c1-5-9-6-13(7-10(9)8-14)11(15)16-12(2,3)4/h5,8-10H,1,6-7H2,2-4H3/t9-,10+/m1/s1 |
| InChIKey | SDAINWUHWQKZPB-ZJUUUORDSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|