C41H51BNO3+ — CID 159011377
bis[(4-methoxyphenyl)methyl]-[1-(4-methoxyphenyl)pentyl]borane;1-butylquinolin-1-ium (PubChem CID 159011377) has the molecular formula C41H51BNO3+ and a molecular weight of 616.68 g/mol. Its IUPAC name is bis[(4-methoxyphenyl)methyl]-[1-(4-methoxyphenyl)pentyl]borane;1-butylquinolin-1-ium.
| Compound Name | bis[(4-methoxyphenyl)methyl]-[1-(4-methoxyphenyl)pentyl]borane;1-butylquinolin-1-ium |
|---|---|
| PubChem CID | 159011377 |
| Molecular Formula | C41H51BNO3+ |
| Molecular Weight | 616.68 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | bis[(4-methoxyphenyl)methyl]-[1-(4-methoxyphenyl)pentyl]borane;1-butylquinolin-1-ium |
| SMILES | CCCCC(B(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1)c1ccc(OC)cc1.CCCC[n+]1cccc2ccccc21 |
| InChI | InChI=1S/C28H35BO3.C13H16N/c1-5-6-7-28(24-12-18-27(32-4)19-13-24)29(20-22-8-14-25(30-2)15-9-22)21-23-10-16-26(31-3)17-11-23;1-2-3-10-14-11-6-8-12-7-4-5-9-13(12)14/h8-19,28H,5-7,20-21H2,1-4H3;4-9,11H,2-3,10H2,1H3/q;+1 |
| InChIKey | JSNLKXCYAPOIKG-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.68 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|