C40H66N2+2 — CID 159012165
1,3-ditert-butylbenzene;dibutyl(phenyl)azanium;[2,6-di(propan-2-yl)phenyl]azanium (PubChem CID 159012165) has the molecular formula C40H66N2+2 and a molecular weight of 574.98 g/mol. Its IUPAC name is 1,3-ditert-butylbenzene;dibutyl(phenyl)azanium;[2,6-di(propan-2-yl)phenyl]azanium.
| Compound Name | 1,3-ditert-butylbenzene;dibutyl(phenyl)azanium;[2,6-di(propan-2-yl)phenyl]azanium |
|---|---|
| PubChem CID | 159012165 |
| Molecular Formula | C40H66N2+2 |
| Molecular Weight | 574.98 g/mol |
| Exact Mass | 574.52 |
| IUPAC Name | 1,3-ditert-butylbenzene;dibutyl(phenyl)azanium;[2,6-di(propan-2-yl)phenyl]azanium |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1.CC(C)c1cccc(C(C)C)c1[NH3+].CCCC[NH+](CCCC)c1ccccc1 |
| InChI | InChI=1S/C14H23N.C14H22.C12H19N/c1-3-5-12-15(13-6-4-2)14-10-8-7-9-11-14;1-13(2,3)11-8-7-9-12(10-11)14(4,5)6;1-8(2)10-6-5-7-11(9(3)4)12(10)13/h7-11H,3-6,12-13H2,1-2H3;7-10H,1-6H3;5-9H,13H2,1-4H3/p+2 |
| InChIKey | JSQAUKPBGPVYRN-UHFFFAOYSA-P |
| XLogP | 9.89 |
| TPSA | 32.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.98 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |