C23H20F2N2O3 — CID 159013963
2-fluoroethyl 3-[2-(aminomethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]benzoate (PubChem CID 159013963) has the molecular formula C23H20F2N2O3 and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-fluoroethyl 3-[2-(aminomethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]benzoate.
| Compound Name | 2-fluoroethyl 3-[2-(aminomethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]benzoate |
|---|---|
| PubChem CID | 159013963 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-fluoroethyl 3-[2-(aminomethyl)-5-[2-(3-fluoro-4-pyridinyl)acetyl]phenyl]benzoate |
| SMILES | NCc1ccc(C(=O)Cc2ccncc2F)cc1-c1cccc(C(=O)OCCF)c1 |
| InChI | InChI=1S/C23H20F2N2O3/c24-7-9-30-23(29)18-3-1-2-15(10-18)20-11-17(4-5-19(20)13-26)22(28)12-16-6-8-27-14-21(16)25/h1-6,8,10-11,14H,7,9,12-13,26H2 |
| InChIKey | JSVUPICCWONITL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |