C27H23N3O3 — CID 72546521
benzyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate (PubChem CID 72546521) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is benzyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate.
| Compound Name | benzyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate |
|---|---|
| PubChem CID | 72546521 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | benzyl 3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]benzoate |
| SMILES | NCc1ccc(C(=O)Nc2ccncc2)cc1-c1cccc(C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H23N3O3/c28-17-23-10-9-21(26(31)30-24-11-13-29-14-12-24)16-25(23)20-7-4-8-22(15-20)27(32)33-18-19-5-2-1-3-6-19/h1-16H,17-18,28H2,(H,29,30,31) |
| InChIKey | NYQIHQFOOXJUQJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |