C22H19N3O2S — CID 89287279
(E)-3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioic S-acid (PubChem CID 89287279) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is (E)-3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioic S-acid.
| Compound Name | (E)-3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioic S-acid |
|---|---|
| PubChem CID | 89287279 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (E)-3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioic S-acid |
| SMILES | NCc1ccc(C(=O)Nc2ccncc2)cc1-c1cccc(/C=C/C(=O)S)c1 |
| InChI | InChI=1S/C22H19N3O2S/c23-14-18-6-5-17(22(27)25-19-8-10-24-11-9-19)13-20(18)16-3-1-2-15(12-16)4-7-21(26)28/h1-13H,14,23H2,(H,26,28)(H,24,25,27)/b7-4+ |
| InChIKey | VCJWBYHBBGLFGV-QPJJXVBHSA-N |
| XLogP | 3.93 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|