C25H26N4O3S — CID 53379696
4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)sulfanylethylamino]phenyl]-N-pyridin-4-ylbenzamide (PubChem CID 53379696) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)sulfanylethylamino]phenyl]-N-pyridin-4-ylbenzamide.
| Compound Name | 4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)sulfanylethylamino]phenyl]-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 53379696 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-(aminomethyl)-3-[3-[2-(2-oxooxolan-3-yl)sulfanylethylamino]phenyl]-N-pyridin-4-ylbenzamide |
| SMILES | NCc1ccc(C(=O)Nc2ccncc2)cc1-c1cccc(NCCSC2CCOC2=O)c1 |
| InChI | InChI=1S/C25H26N4O3S/c26-16-19-5-4-18(24(30)29-20-6-9-27-10-7-20)15-22(19)17-2-1-3-21(14-17)28-11-13-33-23-8-12-32-25(23)31/h1-7,9-10,14-15,23,28H,8,11-13,16,26H2,(H,27,29,30) |
| InChIKey | RVIIYETYOXDZCL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|