C24H23N3O2S — CID 140617778
S-ethyl 3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioate (PubChem CID 140617778) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is S-ethyl 3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioate.
| Compound Name | S-ethyl 3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioate |
|---|---|
| PubChem CID | 140617778 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | S-ethyl 3-[3-[2-(aminomethyl)-5-(pyridin-4-ylcarbamoyl)phenyl]phenyl]prop-2-enethioate |
| SMILES | CCSC(=O)C=Cc1cccc(-c2cc(C(=O)Nc3ccncc3)ccc2CN)c1 |
| InChI | InChI=1S/C24H23N3O2S/c1-2-30-23(28)9-6-17-4-3-5-18(14-17)22-15-19(7-8-20(22)16-25)24(29)27-21-10-12-26-13-11-21/h3-15H,2,16,25H2,1H3,(H,26,27,29) |
| InChIKey | QHQCOAQTAXNEKA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|